C22H25N7O5 — CID 110162969
7-[(3R,4R,6S)-1-(3H-benzimidazole-5-carbonyl)-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110162969) has the molecular formula C22H25N7O5 and a molecular weight of 467.49 g/mol. Its IUPAC name is 7-[(3R,4R,6S)-1-(3H-benzimidazole-5-carbonyl)-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3R,4R,6S)-1-(3H-benzimidazole-5-carbonyl)-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110162969 |
| Molecular Formula | C22H25N7O5 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 7-[(3R,4R,6S)-1-(3H-benzimidazole-5-carbonyl)-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2[C@@H]2CN(C(=O)c3ccc4nc[nH]c4c3)C[C@@H](O)C[C@@]2(C)O)n(C)c1=O |
| InChI | InChI=1S/C22H25N7O5/c1-22(34)7-13(30)8-28(19(31)12-4-5-14-15(6-12)24-10-23-14)9-16(22)29-11-25-18-17(29)20(32)27(3)21(33)26(18)2/h4-6,10-11,13,16,30,34H,7-9H2,1-3H3,(H,23,24)/t13-,16+,22+/m0/s1 |
| InChIKey | RLMCDTVNYUJJCJ-JWCWZOIMSA-N |
| XLogP | -0.49 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |