C28H37N7O5 — CID 110162975
7-[(3R,4R,6S)-4,6-dihydroxy-4-methyl-1-[4-(2-propan-2-ylbenzimidazol-1-yl)butanoyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110162975) has the molecular formula C28H37N7O5 and a molecular weight of 551.65 g/mol. Its IUPAC name is 7-[(3R,4R,6S)-4,6-dihydroxy-4-methyl-1-[4-(2-propan-2-ylbenzimidazol-1-yl)butanoyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3R,4R,6S)-4,6-dihydroxy-4-methyl-1-[4-(2-propan-2-ylbenzimidazol-1-yl)butanoyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110162975 |
| Molecular Formula | C28H37N7O5 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | 7-[(3R,4R,6S)-4,6-dihydroxy-4-methyl-1-[4-(2-propan-2-ylbenzimidazol-1-yl)butanoyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | CC(C)c1nc2ccccc2n1CCCC(=O)N1C[C@@H](O)C[C@@](C)(O)[C@H](n2cnc3c2c(=O)n(C)c(=O)n3C)C1 |
| InChI | InChI=1S/C28H37N7O5/c1-17(2)24-30-19-9-6-7-10-20(19)34(24)12-8-11-22(37)33-14-18(36)13-28(3,40)21(15-33)35-16-29-25-23(35)26(38)32(5)27(39)31(25)4/h6-7,9-10,16-18,21,36,40H,8,11-15H2,1-5H3/t18-,21+,28+/m0/s1 |
| InChIKey | CYJIOKXPXDUIGG-ZRUQVRLOSA-N |
| XLogP | 1.27 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |