C25H31N7O6 — CID 110162936
7-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-[(6-methyl-1H-benzimidazol-2-yl)methoxy]acetyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110162936) has the molecular formula C25H31N7O6 and a molecular weight of 525.57 g/mol. Its IUPAC name is 7-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-[(6-methyl-1H-benzimidazol-2-yl)methoxy]acetyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-[(6-methyl-1H-benzimidazol-2-yl)methoxy]acetyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110162936 |
| Molecular Formula | C25H31N7O6 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 7-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-[(6-methyl-1H-benzimidazol-2-yl)methoxy]acetyl]azepan-3-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1ccc2nc(COCC(=O)N3C[C@H](O)C[C@](C)(O)[C@@H](n4cnc5c4c(=O)n(C)c(=O)n5C)C3)[nH]c2c1 |
| InChI | InChI=1S/C25H31N7O6/c1-14-5-6-16-17(7-14)28-19(27-16)11-38-12-20(34)31-9-15(33)8-25(2,37)18(10-31)32-13-26-22-21(32)23(35)30(4)24(36)29(22)3/h5-7,13,15,18,33,37H,8-12H2,1-4H3,(H,27,28)/t15-,18+,25+/m1/s1 |
| InChIKey | OQPPIJNXZBPFLU-DZQNVJDRSA-N |
| XLogP | -0.28 |
| TPSA | 160.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |