C25H31N7O4 — CID 110163482
7-[(3S,4S)-4-hydroxy-4-methyl-1-[2-(2,5,6-trimethylbenzimidazol-1-yl)acetyl]piperidin-3-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 110163482) has the molecular formula C25H31N7O4 and a molecular weight of 493.57 g/mol. Its IUPAC name is 7-[(3S,4S)-4-hydroxy-4-methyl-1-[2-(2,5,6-trimethylbenzimidazol-1-yl)acetyl]piperidin-3-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3S,4S)-4-hydroxy-4-methyl-1-[2-(2,5,6-trimethylbenzimidazol-1-yl)acetyl]piperidin-3-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 110163482 |
| Molecular Formula | C25H31N7O4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 7-[(3S,4S)-4-hydroxy-4-methyl-1-[2-(2,5,6-trimethylbenzimidazol-1-yl)acetyl]piperidin-3-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cc1cc2nc(C)n(CC(=O)N3CC[C@](C)(O)[C@@H](n4cnc5c4c(=O)n(C)c(=O)n5C)C3)c2cc1C |
| InChI | InChI=1S/C25H31N7O4/c1-14-9-17-18(10-15(14)2)31(16(3)27-17)12-20(33)30-8-7-25(4,36)19(11-30)32-13-26-22-21(32)23(34)29(6)24(35)28(22)5/h9-10,13,19,36H,7-8,11-12H2,1-6H3/t19-,25-/m0/s1 |
| InChIKey | ILICKIGZMIYDJV-DFBJGRDBSA-N |
| XLogP | 0.93 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |