C26H34N6O5 — CID 155989805
7-[(3S,4S,6R)-1-[4-(1,3-dihydroisoindol-2-yl)butanoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione (PubChem CID 155989805) has the molecular formula C26H34N6O5 and a molecular weight of 510.60 g/mol. Its IUPAC name is 7-[(3S,4S,6R)-1-[4-(1,3-dihydroisoindol-2-yl)butanoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-[(3S,4S,6R)-1-[4-(1,3-dihydroisoindol-2-yl)butanoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 155989805 |
| Molecular Formula | C26H34N6O5 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 7-[(3S,4S,6R)-1-[4-(1,3-dihydroisoindol-2-yl)butanoyl]-4,6-dihydroxy-4-methylazepan-3-yl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2[C@H]2CN(C(=O)CCCN3Cc4ccccc4C3)C[C@H](O)C[C@]2(C)O)n(C)c1=O |
| InChI | InChI=1S/C26H34N6O5/c1-26(37)11-19(33)14-31(21(34)9-6-10-30-12-17-7-4-5-8-18(17)13-30)15-20(26)32-16-27-23-22(32)24(35)29(3)25(36)28(23)2/h4-5,7-8,16,19-20,33,37H,6,9-15H2,1-3H3/t19-,20+,26+/m1/s1 |
| InChIKey | ZJMVOMQHNRGTPV-GOHWNWGWSA-N |
| XLogP | 0.12 |
| TPSA | 125.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |