C16H14N6O4 — CID 135679874
2-[3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropyl]isoindole-1,3-dione (PubChem CID 135679874) has the molecular formula C16H14N6O4 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-[3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 135679874 |
| Molecular Formula | C16H14N6O4 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-[3-(2-amino-6-oxo-1H-purin-7-yl)-2-hydroxypropyl]isoindole-1,3-dione |
| SMILES | Nc1nc2ncn(CC(O)CN3C(=O)c4ccccc4C3=O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N6O4/c17-16-19-12-11(13(24)20-16)21(7-18-12)5-8(23)6-22-14(25)9-3-1-2-4-10(9)15(22)26/h1-4,7-8,23H,5-6H2,(H3,17,19,20,24) |
| InChIKey | XGJHHSZMHPMHQR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|