C21H22F3N5O5 — CID 110163050
1-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-(trifluoromethyl)-3H-benzimidazole-5-carbonyl]azepan-3-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 110163050) has the molecular formula C21H22F3N5O5 and a molecular weight of 481.43 g/mol. Its IUPAC name is 1-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-(trifluoromethyl)-3H-benzimidazole-5-carbonyl]azepan-3-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-(trifluoromethyl)-3H-benzimidazole-5-carbonyl]azepan-3-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 110163050 |
| Molecular Formula | C21H22F3N5O5 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 1-[(3S,4S,6R)-4,6-dihydroxy-4-methyl-1-[2-(trifluoromethyl)-3H-benzimidazole-5-carbonyl]azepan-3-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CN(C(=O)c3ccc4nc(C(F)(F)F)[nH]c4c3)C[C@H](O)C[C@]2(C)O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H22F3N5O5/c1-10-7-29(19(33)27-16(10)31)15-9-28(8-12(30)6-20(15,2)34)17(32)11-3-4-13-14(5-11)26-18(25-13)21(22,23)24/h3-5,7,12,15,30,34H,6,8-9H2,1-2H3,(H,25,26)(H,27,31,33)/t12-,15+,20+/m1/s1 |
| InChIKey | ILHHMQCSVGLBJC-RAJNIJHNSA-N |
| XLogP | 0.94 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |