C21H28N8O4 — CID 110154548
[3-(2-aminoethoxy)phenyl]-[(3R,4R,6S)-3-(2,6-diaminopurin-9-yl)-4,6-dihydroxy-4-methylazepan-1-yl]methanone (PubChem CID 110154548) has the molecular formula C21H28N8O4 and a molecular weight of 456.51 g/mol. Its IUPAC name is [3-(2-aminoethoxy)phenyl]-[(3R,4R,6S)-3-(2,6-diaminopurin-9-yl)-4,6-dihydroxy-4-methylazepan-1-yl]methanone.
| Compound Name | [3-(2-aminoethoxy)phenyl]-[(3R,4R,6S)-3-(2,6-diaminopurin-9-yl)-4,6-dihydroxy-4-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 110154548 |
| Molecular Formula | C21H28N8O4 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | [3-(2-aminoethoxy)phenyl]-[(3R,4R,6S)-3-(2,6-diaminopurin-9-yl)-4,6-dihydroxy-4-methylazepan-1-yl]methanone |
| SMILES | C[C@@]1(O)C[C@H](O)CN(C(=O)c2cccc(OCCN)c2)C[C@H]1n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C21H28N8O4/c1-21(32)8-13(30)9-28(19(31)12-3-2-4-14(7-12)33-6-5-22)10-15(21)29-11-25-16-17(23)26-20(24)27-18(16)29/h2-4,7,11,13,15,30,32H,5-6,8-10,22H2,1H3,(H4,23,24,26,27)/t13-,15+,21+/m0/s1 |
| InChIKey | WNWZPCQPXJXNCD-QDUSTFBWSA-N |
| XLogP | -0.47 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |