C21H34N8O4 — CID 110158372
(2S)-6-acetamido-2-amino-N-[(1R,3S,4S)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylhexanamide (PubChem CID 110158372) has the molecular formula C21H34N8O4 and a molecular weight of 462.56 g/mol. Its IUPAC name is (2S)-6-acetamido-2-amino-N-[(1R,3S,4S)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylhexanamide.
| Compound Name | (2S)-6-acetamido-2-amino-N-[(1R,3S,4S)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 110158372 |
| Molecular Formula | C21H34N8O4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2S)-6-acetamido-2-amino-N-[(1R,3S,4S)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylhexanamide |
| SMILES | CC(=O)NCCCC[C@H](N)C(=O)N(C)[C@@H]1CC[C@](O)(Cn2cnc3c(N)ncnc32)[C@@H](O)C1 |
| InChI | InChI=1S/C21H34N8O4/c1-13(30)24-8-4-3-5-15(22)20(32)28(2)14-6-7-21(33,16(31)9-14)10-29-12-27-17-18(23)25-11-26-19(17)29/h11-12,14-16,31,33H,3-10,22H2,1-2H3,(H,24,30)(H2,23,25,26)/t14-,15+,16+,21+/m1/s1 |
| InChIKey | YEPAPGWIPJMJEY-JXSLOMFPSA-N |
| XLogP | -0.85 |
| TPSA | 185.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|