C23H31N7O4 — CID 110153803
4-(3-aminopropoxy)-N-[(1S,3R,4R)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylbenzamide (PubChem CID 110153803) has the molecular formula C23H31N7O4 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-(3-aminopropoxy)-N-[(1S,3R,4R)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylbenzamide.
| Compound Name | 4-(3-aminopropoxy)-N-[(1S,3R,4R)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110153803 |
| Molecular Formula | C23H31N7O4 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 4-(3-aminopropoxy)-N-[(1S,3R,4R)-4-[(6-aminopurin-9-yl)methyl]-3,4-dihydroxycyclohexyl]-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(OCCCN)cc1)[C@H]1CC[C@@](O)(Cn2cnc3c(N)ncnc32)[C@H](O)C1 |
| InChI | InChI=1S/C23H31N7O4/c1-29(22(32)15-3-5-17(6-4-15)34-10-2-9-24)16-7-8-23(33,18(31)11-16)12-30-14-28-19-20(25)26-13-27-21(19)30/h3-6,13-14,16,18,31,33H,2,7-12,24H2,1H3,(H2,25,26,27)/t16-,18+,23+/m0/s1 |
| InChIKey | YZENMBYXUMUFQC-PRCFCKQXSA-N |
| XLogP | 0.55 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|