C17H27N9O5 — CID 101288446
(2S)-2-amino-N-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-6-(carbamoylamino)hexanamide (PubChem CID 101288446) has the molecular formula C17H27N9O5 and a molecular weight of 437.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-6-(carbamoylamino)hexanamide.
| Compound Name | (2S)-2-amino-N-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-6-(carbamoylamino)hexanamide |
|---|---|
| PubChem CID | 101288446 |
| Molecular Formula | C17H27N9O5 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-6-(carbamoylamino)hexanamide |
| SMILES | NC(=O)NCCCC[C@H](N)C(=O)N[C@H]1[C@@H](O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C17H27N9O5/c18-8(3-1-2-4-21-17(20)30)15(29)25-10-9(5-27)31-16(12(10)28)26-7-24-11-13(19)22-6-23-14(11)26/h6-10,12,16,27-28H,1-5,18H2,(H,25,29)(H2,19,22,23)(H3,20,21,30)/t8-,9+,10+,12+,16+/m0/s1 |
| InChIKey | PRSGILKSOMZEFX-GBPQWNHNSA-N |
| XLogP | -2.69 |
| TPSA | 229.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|