C16H27ClN5O4P — CID 142878446
5-chloro-8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]-2,4,7,8-tetrazabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine (PubChem CID 142878446) has the molecular formula C16H27ClN5O4P and a molecular weight of 419.85 g/mol. Its IUPAC name is 5-chloro-8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]-2,4,7,8-tetrazabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine.
| Compound Name | 5-chloro-8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]-2,4,7,8-tetrazabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
|---|---|
| PubChem CID | 142878446 |
| Molecular Formula | C16H27ClN5O4P |
| Molecular Weight | 419.85 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 5-chloro-8-[[1-[di(propan-2-yloxy)phosphorylmethoxy]-2-methylcyclopropyl]methyl]-2,4,7,8-tetrazabicyclo[4.2.0]octa-1(6),2,4-trien-3-amine |
| SMILES | CC(C)OP(=O)(COC1(Cn2[nH]c3c(Cl)nc(N)nc32)CC1C)OC(C)C |
| InChI | InChI=1S/C16H27ClN5O4P/c1-9(2)25-27(23,26-10(3)4)8-24-16(6-11(16)5)7-22-14-12(21-22)13(17)19-15(18)20-14/h9-11,21H,6-8H2,1-5H3,(H2,18,19,20) |
| InChIKey | IXPJCXHPYTXZPU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|