C24H31N6O8PS — CID 173082863
[[1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]-2-methylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 173082863) has the molecular formula C24H31N6O8PS and a molecular weight of 594.59 g/mol. Its IUPAC name is [[1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]-2-methylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]-2-methylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173082863 |
| Molecular Formula | C24H31N6O8PS |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.17 |
| IUPAC Name | [[1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]-2-methylcyclopropyl]oxymethyl-methoxyphosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | COP(=O)(COC1(Cn2cnc3c(Sc4ccc([N+](=O)[O-])cc4)nc(N)nc32)CC1C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C24H31N6O8PS/c1-15-10-24(15,37-14-39(34,35-5)38-13-36-21(31)23(2,3)4)11-29-12-26-18-19(29)27-22(25)28-20(18)40-17-8-6-16(7-9-17)30(32)33/h6-9,12,15H,10-11,13-14H2,1-5H3,(H2,25,27,28) |
| InChIKey | BHWBXLFAHUXVRS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 183.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|