C26H33N6O12PS — CID 91479054
[1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]peroxy-[1,3-bis(propan-2-yloxycarbonyloxy)propan-2-yl]phosphinic acid (PubChem CID 91479054) has the molecular formula C26H33N6O12PS and a molecular weight of 684.62 g/mol. Its IUPAC name is [1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]peroxy-[1,3-bis(propan-2-yloxycarbonyloxy)propan-2-yl]phosphinic acid.
| Compound Name | [1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]peroxy-[1,3-bis(propan-2-yloxycarbonyloxy)propan-2-yl]phosphinic acid |
|---|---|
| PubChem CID | 91479054 |
| Molecular Formula | C26H33N6O12PS |
| Molecular Weight | 684.62 g/mol |
| Exact Mass | 684.16 |
| IUPAC Name | [1-[[2-amino-6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]peroxy-[1,3-bis(propan-2-yloxycarbonyloxy)propan-2-yl]phosphinic acid |
| SMILES | CC(C)OC(=O)OCC(COC(=O)OC(C)C)P(=O)(O)OOC1(Cn2cnc3c(Sc4ccc([N+](=O)[O-])cc4)nc(N)nc32)CC1 |
| InChI | InChI=1S/C26H33N6O12PS/c1-15(2)41-24(33)39-11-18(12-40-25(34)42-16(3)4)45(37,38)44-43-26(9-10-26)13-31-14-28-20-21(31)29-23(27)30-22(20)46-19-7-5-17(6-8-19)32(35)36/h5-8,14-16,18H,9-13H2,1-4H3,(H,37,38)(H2,27,29,30) |
| InChIKey | KFUBLBSMBDBJCU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 239.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|