C28H36N5O12PS — CID 10168953
tert-butyl [(2-methylpropan-2-yl)oxycarbonyloxymethoxy-[[1-[[6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]oxymethyl]phosphoryl]oxymethyl carbonate (PubChem CID 10168953) has the molecular formula C28H36N5O12PS and a molecular weight of 697.66 g/mol. Its IUPAC name is tert-butyl [(2-methylpropan-2-yl)oxycarbonyloxymethoxy-[[1-[[6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]oxymethyl]phosphoryl]oxymethyl carbonate.
| Compound Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyloxymethoxy-[[1-[[6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]oxymethyl]phosphoryl]oxymethyl carbonate |
|---|---|
| PubChem CID | 10168953 |
| Molecular Formula | C28H36N5O12PS |
| Molecular Weight | 697.66 g/mol |
| Exact Mass | 697.18 |
| IUPAC Name | tert-butyl [(2-methylpropan-2-yl)oxycarbonyloxymethoxy-[[1-[[6-(4-nitrophenyl)sulfanylpurin-9-yl]methyl]cyclopropyl]oxymethyl]phosphoryl]oxymethyl carbonate |
| SMILES | CC(C)(C)OC(=O)OCOP(=O)(COC1(Cn2cnc3c(Sc4ccc([N+](=O)[O-])cc4)ncnc32)CC1)OCOC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H36N5O12PS/c1-26(2,3)44-24(34)39-16-42-46(38,43-17-40-25(35)45-27(4,5)6)18-41-28(11-12-28)13-32-15-31-21-22(32)29-14-30-23(21)47-20-9-7-19(8-10-20)33(36)37/h7-10,14-15H,11-13,16-18H2,1-6H3 |
| InChIKey | LBYCWQRKQNERJG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 202.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.66 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|