C30H40N5O9PS — CID 89287131
[[1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-[cyclopentyl(formyloxy)methoxy]phosphoryl]oxy-cyclopentylmethyl] formate (PubChem CID 89287131) has the molecular formula C30H40N5O9PS and a molecular weight of 677.72 g/mol. Its IUPAC name is [[1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-[cyclopentyl(formyloxy)methoxy]phosphoryl]oxy-cyclopentylmethyl] formate.
| Compound Name | [[1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-[cyclopentyl(formyloxy)methoxy]phosphoryl]oxy-cyclopentylmethyl] formate |
|---|---|
| PubChem CID | 89287131 |
| Molecular Formula | C30H40N5O9PS |
| Molecular Weight | 677.72 g/mol |
| Exact Mass | 677.23 |
| IUPAC Name | [[1-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]propan-2-yloxymethyl-[cyclopentyl(formyloxy)methoxy]phosphoryl]oxy-cyclopentylmethyl] formate |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CC(C)OCP(=O)(OC(OC=O)C2CCCC2)OC(OC=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C30H40N5O9PS/c1-20(15-35-16-32-25-26(35)33-30(31)34-27(25)46-24-13-11-23(39-2)12-14-24)42-19-45(38,43-28(40-17-36)21-7-3-4-8-21)44-29(41-18-37)22-9-5-6-10-22/h11-14,16-18,20-22,28-29H,3-10,15,19H2,1-2H3,(H2,31,33,34) |
| InChIKey | NGDPFSMKJYQJBC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|