C25H34N5O11PS — CID 89286896
[[2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-[formyloxy(propan-2-yloxy)methoxy]phosphoryl]oxy-propan-2-yloxymethyl] formate (PubChem CID 89286896) has the molecular formula C25H34N5O11PS and a molecular weight of 643.61 g/mol. Its IUPAC name is [[2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-[formyloxy(propan-2-yloxy)methoxy]phosphoryl]oxy-propan-2-yloxymethyl] formate.
| Compound Name | [[2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-[formyloxy(propan-2-yloxy)methoxy]phosphoryl]oxy-propan-2-yloxymethyl] formate |
|---|---|
| PubChem CID | 89286896 |
| Molecular Formula | C25H34N5O11PS |
| Molecular Weight | 643.61 g/mol |
| Exact Mass | 643.17 |
| IUPAC Name | [[2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-[formyloxy(propan-2-yloxy)methoxy]phosphoryl]oxy-propan-2-yloxymethyl] formate |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CCOCP(=O)(OC(OC=O)OC(C)C)OC(OC=O)OC(C)C)cc1 |
| InChI | InChI=1S/C25H34N5O11PS/c1-16(2)38-24(36-13-31)40-42(33,41-25(37-14-32)39-17(3)4)15-35-11-10-30-12-27-20-21(30)28-23(26)29-22(20)43-19-8-6-18(34-5)7-9-19/h6-9,12-14,16-17,24-25H,10-11,15H2,1-5H3,(H2,26,28,29) |
| InChIKey | RZQCEDVXUZZMAX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 194.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|