C31H42N5O11PS — CID 89049024
[2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxy-bis[cyclohexyl(formyloxy)methoxy]methyl]phosphonic acid (PubChem CID 89049024) has the molecular formula C31H42N5O11PS and a molecular weight of 723.74 g/mol. Its IUPAC name is [2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxy-bis[cyclohexyl(formyloxy)methoxy]methyl]phosphonic acid.
| Compound Name | [2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxy-bis[cyclohexyl(formyloxy)methoxy]methyl]phosphonic acid |
|---|---|
| PubChem CID | 89049024 |
| Molecular Formula | C31H42N5O11PS |
| Molecular Weight | 723.74 g/mol |
| Exact Mass | 723.23 |
| IUPAC Name | [2-[2-amino-6-(4-methoxyphenyl)sulfanylpurin-9-yl]ethoxy-bis[cyclohexyl(formyloxy)methoxy]methyl]phosphonic acid |
| SMILES | COc1ccc(Sc2nc(N)nc3c2ncn3CCOC(OC(OC=O)C2CCCCC2)(OC(OC=O)C2CCCCC2)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C31H42N5O11PS/c1-42-23-12-14-24(15-13-23)49-27-25-26(34-30(32)35-27)36(18-33-25)16-17-45-31(48(39,40)41,46-28(43-19-37)21-8-4-2-5-9-21)47-29(44-20-38)22-10-6-3-7-11-22/h12-15,18-22,28-29H,2-11,16-17H2,1H3,(H2,32,34,35)(H2,39,40,41) |
| InChIKey | OLAVLRLDGXPNEI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 216.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.74 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|