C16H17F3N5O4PS — CID 24887687
2-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid (PubChem CID 24887687) has the molecular formula C16H17F3N5O4PS and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid.
| Compound Name | 2-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
|---|---|
| PubChem CID | 24887687 |
| Molecular Formula | C16H17F3N5O4PS |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 2-[2-amino-6-(3-hydroxyphenyl)sulfanylpurin-9-yl]ethoxymethyl-(2,2,2-trifluoroethyl)phosphinic acid |
| SMILES | Nc1nc(Sc2cccc(O)c2)c2ncn(CCOCP(=O)(O)CC(F)(F)F)c2n1 |
| InChI | InChI=1S/C16H17F3N5O4PS/c17-16(18,19)7-29(26,27)9-28-5-4-24-8-21-12-13(24)22-15(20)23-14(12)30-11-3-1-2-10(25)6-11/h1-3,6,8,25H,4-5,7,9H2,(H,26,27)(H2,20,22,23) |
| InChIKey | HFENWOTZUPTKBH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|