C19H26N5O2PS — CID 70186505
6-(3-butoxyphenyl)sulfanyl-9-[2-(phosphanylmethoxy)propyl]purin-2-amine (PubChem CID 70186505) has the molecular formula C19H26N5O2PS and a molecular weight of 419.49 g/mol. Its IUPAC name is 6-(3-butoxyphenyl)sulfanyl-9-[2-(phosphanylmethoxy)propyl]purin-2-amine.
| Compound Name | 6-(3-butoxyphenyl)sulfanyl-9-[2-(phosphanylmethoxy)propyl]purin-2-amine |
|---|---|
| PubChem CID | 70186505 |
| Molecular Formula | C19H26N5O2PS |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 6-(3-butoxyphenyl)sulfanyl-9-[2-(phosphanylmethoxy)propyl]purin-2-amine |
| SMILES | CCCCOc1cccc(Sc2nc(N)nc3c2ncn3CC(C)OCP)c1 |
| InChI | InChI=1S/C19H26N5O2PS/c1-3-4-8-25-14-6-5-7-15(9-14)28-18-16-17(22-19(20)23-18)24(11-21-16)10-13(2)26-12-27/h5-7,9,11,13H,3-4,8,10,12,27H2,1-2H3,(H2,20,22,23) |
| InChIKey | PUIHKPPCFYMLAS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|