C20H31ClN5O5P — CID 59157882
(1R,2R,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]-1,5-dimethyl-3-methylidenecyclopentan-1-ol (PubChem CID 59157882) has the molecular formula C20H31ClN5O5P and a molecular weight of 487.93 g/mol. Its IUPAC name is (1R,2R,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]-1,5-dimethyl-3-methylidenecyclopentan-1-ol.
| Compound Name | (1R,2R,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]-1,5-dimethyl-3-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 59157882 |
| Molecular Formula | C20H31ClN5O5P |
| Molecular Weight | 487.93 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | (1R,2R,4R,5R)-2-(2-amino-6-chloropurin-9-yl)-4-[di(propan-2-yloxy)phosphorylmethoxy]-1,5-dimethyl-3-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@H](OCP(=O)(OC(C)C)OC(C)C)[C@@H](C)[C@@](C)(O)[C@@H]1n1cnc2c(Cl)nc(N)nc21 |
| InChI | InChI=1S/C20H31ClN5O5P/c1-10(2)30-32(28,31-11(3)4)9-29-15-12(5)16(20(7,27)13(15)6)26-8-23-14-17(21)24-19(22)25-18(14)26/h8,10-11,13,15-16,27H,5,9H2,1-4,6-7H3,(H2,22,24,25)/t13-,15+,16-,20-/m1/s1 |
| InChIKey | GMNNDENVSQLZBP-LLKNDRQVSA-N |
| XLogP | 3.95 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|