C16H24N5O7P — CID 148548916
[1-[(2-aminopurin-9-yl)methyl]-2-methylcyclopropyl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid (PubChem CID 148548916) has the molecular formula C16H24N5O7P and a molecular weight of 429.37 g/mol. Its IUPAC name is [1-[(2-aminopurin-9-yl)methyl]-2-methylcyclopropyl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid.
| Compound Name | [1-[(2-aminopurin-9-yl)methyl]-2-methylcyclopropyl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
|---|---|
| PubChem CID | 148548916 |
| Molecular Formula | C16H24N5O7P |
| Molecular Weight | 429.37 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [1-[(2-aminopurin-9-yl)methyl]-2-methylcyclopropyl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphinic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(O)COC1(Cn2cnc3cnc(N)nc32)CC1C |
| InChI | InChI=1S/C16H24N5O7P/c1-10(2)28-15(22)25-8-27-29(23,24)9-26-16(4-11(16)3)6-21-7-19-12-5-18-14(17)20-13(12)21/h5,7,10-11H,4,6,8-9H2,1-3H3,(H,23,24)(H2,17,18,20) |
| InChIKey | XPWYEISCBOTRPL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|