C26H29N6O5P — CID 90468401
benzyl (2S)-2-[[[1-[(2-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 90468401) has the molecular formula C26H29N6O5P and a molecular weight of 536.53 g/mol. Its IUPAC name is benzyl (2S)-2-[[[1-[(2-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[1-[(2-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 90468401 |
| Molecular Formula | C26H29N6O5P |
| Molecular Weight | 536.53 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | benzyl (2S)-2-[[[1-[(2-aminopurin-9-yl)methyl]cyclopropyl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(COC1(Cn2cnc3cnc(N)nc32)CC1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29N6O5P/c1-19(24(33)35-15-20-8-4-2-5-9-20)31-38(34,37-21-10-6-3-7-11-21)18-36-26(12-13-26)16-32-17-29-22-14-28-25(27)30-23(22)32/h2-11,14,17,19H,12-13,15-16,18H2,1H3,(H,31,34)(H2,27,28,30)/t19-,38?/m0/s1 |
| InChIKey | AOCAFISGJCKFQB-BLVCMUQISA-N |
| XLogP | 3.91 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|