C19H32N5O4P — CID 91581427
[(1R,2R)-1-[(6-aminopurin-9-yl)methyl]-2-propylcyclopropyl]peroxy-(2,4-dimethylpentan-3-yl)phosphinic acid (PubChem CID 91581427) has the molecular formula C19H32N5O4P and a molecular weight of 425.47 g/mol. Its IUPAC name is [(1R,2R)-1-[(6-aminopurin-9-yl)methyl]-2-propylcyclopropyl]peroxy-(2,4-dimethylpentan-3-yl)phosphinic acid.
| Compound Name | [(1R,2R)-1-[(6-aminopurin-9-yl)methyl]-2-propylcyclopropyl]peroxy-(2,4-dimethylpentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 91581427 |
| Molecular Formula | C19H32N5O4P |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(1R,2R)-1-[(6-aminopurin-9-yl)methyl]-2-propylcyclopropyl]peroxy-(2,4-dimethylpentan-3-yl)phosphinic acid |
| SMILES | CCC[C@@H]1C[C@@]1(Cn1cnc2c(N)ncnc21)OOP(=O)(O)C(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32N5O4P/c1-6-7-14-8-19(14,27-28-29(25,26)16(12(2)3)13(4)5)9-24-11-23-15-17(20)21-10-22-18(15)24/h10-14,16H,6-9H2,1-5H3,(H,25,26)(H2,20,21,22)/t14-,19+/m1/s1 |
| InChIKey | BEIFHCKTMRQNAG-KUHUBIRLSA-N |
| XLogP | 3.78 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|