C24H37N6O10PS — CID 123910448
S-[2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 4-(ethoxycarbonylamino)-2,2-dimethylbutanethioate (PubChem CID 123910448) has the molecular formula C24H37N6O10PS and a molecular weight of 632.63 g/mol. Its IUPAC name is S-[2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 4-(ethoxycarbonylamino)-2,2-dimethylbutanethioate.
| Compound Name | S-[2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 4-(ethoxycarbonylamino)-2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 123910448 |
| Molecular Formula | C24H37N6O10PS |
| Molecular Weight | 632.63 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | S-[2-[[6-(2-amino-6-ethoxypurin-9-yl)-7-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]ethyl] 4-(ethoxycarbonylamino)-2,2-dimethylbutanethioate |
| SMILES | CCOC(=O)NCCC(C)(C)C(=O)SCCOP1(=O)OCC2OC(n3cnc4c(OCC)nc(N)nc43)C(C)(O)C2O1 |
| InChI | InChI=1S/C24H37N6O10PS/c1-6-35-18-15-17(28-21(25)29-18)30(13-27-15)19-24(5,33)16-14(39-19)12-38-41(34,40-16)37-10-11-42-20(31)23(3,4)8-9-26-22(32)36-7-2/h13-14,16,19,33H,6-12H2,1-5H3,(H,26,32)(H2,25,28,29) |
| InChIKey | JKXOZLHDVDPXQM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 208.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.63 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|