C17H23FN5O8P — CID 118983196
propan-2-yl 2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-methoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetate (PubChem CID 118983196) has the molecular formula C17H23FN5O8P and a molecular weight of 475.37 g/mol. Its IUPAC name is propan-2-yl 2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-methoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetate.
| Compound Name | propan-2-yl 2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-methoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetate |
|---|---|
| PubChem CID | 118983196 |
| Molecular Formula | C17H23FN5O8P |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | propan-2-yl 2-[[(2R,4aR,6R,7R,7aR)-6-(2-amino-6-methoxypurin-9-yl)-7-fluoro-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-2-yl]oxy]acetate |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2CO[P@](=O)(OCC(=O)OC(C)C)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C17H23FN5O8P/c1-8(2)29-10(24)6-28-32(25)27-5-9-12(31-32)17(3,18)15(30-9)23-7-20-11-13(23)21-16(19)22-14(11)26-4/h7-9,12,15H,5-6H2,1-4H3,(H2,19,21,22)/t9-,12-,15-,17-,32-/m1/s1 |
| InChIKey | DSPRNFJWLPDYGK-HPPZUHCVSA-N |
| XLogP | 1.53 |
| TPSA | 159.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|