About CID 90088680
CID 90088680 (PubChem CID 90088680) has the molecular formula C13H14BN5O5PS+
and a molecular weight of 394.14 g/mol.
Molecular Properties
| Compound Name | CID 90088680 |
| PubChem CID | 90088680 |
| Molecular Formula | C13H14BN5O5PS+ |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | — |
| SMILES | [B][P+]1(OCCC#N)OC[C@H]2O[C@@H](n3cnc4c(=S)nc[nH]c43)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H14BN5O5PS/c14-25(21-3-1-2-15)22-4-7-10(24-25)9(20)13(23-7)19-6-18-8-11(19)16-5-17-12(8)26/h5-7,9-10,13,20H,1,3-4H2,(H,16,17,26)/q+1/t7-,9+,10+,13-,25?/m1/s1 |
| InChIKey | RRUHCPXDPPVFPV-NFQKCWFISA-N |
| XLogP | 0.94 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 90088680 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90088680?
The IUPAC name of CID 90088680 (CID 90088680) is not available.
What is the SMILES notation for CID 90088680?
The canonical SMILES for CID 90088680 is [B][P+]1(OCCC#N)OC[C@H]2O[C@@H](n3cnc4c(=S)nc[nH]c43)[C@@H](O)[C@H]2O1.
What is the InChIKey of CID 90088680?
The InChIKey is RRUHCPXDPPVFPV-NFQKCWFISA-N. The full InChI is InChI=1S/C13H14BN5O5PS/c14-25(21-3-1-2-15)22-4-7-10(24-25)9(20)13(23-7)19-6-18-8-11(19)16-5-17-12(8)26/h5-7,9-10,13,20H,1,3-4H2,(H,16,17,26)/q+1/t7-,9+,10+,13-,25?/m1/s1.
What are the key properties of CID 90088680?
CID 90088680 has a molecular weight of 394.14 g/mol, XLogP of 0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90088680 is sourced from PubChem (CID 90088680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).