C13H14BN5O5PS+ — CID 90088680
CID 90088680 (PubChem CID 90088680) has the molecular formula C13H14BN5O5PS+ and a molecular weight of 394.14 g/mol.
| Compound Name | CID 90088680 |
|---|---|
| PubChem CID | 90088680 |
| Molecular Formula | C13H14BN5O5PS+ |
| Molecular Weight | 394.14 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | — |
| SMILES | [B][P+]1(OCCC#N)OC[C@H]2O[C@@H](n3cnc4c(=S)nc[nH]c43)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C13H14BN5O5PS/c14-25(21-3-1-2-15)22-4-7-10(24-25)9(20)13(23-7)19-6-18-8-11(19)16-5-17-12(8)26/h5-7,9-10,13,20H,1,3-4H2,(H,16,17,26)/q+1/t7-,9+,10+,13-,25?/m1/s1 |
| InChIKey | RRUHCPXDPPVFPV-NFQKCWFISA-N |
| XLogP | 0.94 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.14 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|