C12H15BN4O6P+ — CID 123903182
CID 123903182 (PubChem CID 123903182) has the molecular formula C12H15BN4O6P+ and a molecular weight of 353.06 g/mol.
| Compound Name | CID 123903182 |
|---|---|
| PubChem CID | 123903182 |
| Molecular Formula | C12H15BN4O6P+ |
| Molecular Weight | 353.06 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | — |
| SMILES | [B][P+]1(OCC[N+]#[C-])OC[C@H]2O[C@@H](n3ccc(N)nc3=O)C(O)[C@@H]2O1 |
| InChI | InChI=1S/C12H15BN4O6P/c1-15-3-5-20-24(13)21-6-7-10(23-24)9(18)11(22-7)17-4-2-8(14)16-12(17)19/h2,4,7,9-11,18H,3,5-6H2,(H2,14,16,19)/q+1/t7-,9?,10-,11-,24?/m1/s1 |
| InChIKey | PHISVICQGVPZOZ-HBKGEAQLSA-N |
| XLogP | -0.72 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.06 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|