C18H21N3O7 — CID 58940489
1-[(4aR,6R,7R,8R,9R,9aS)-7,8,9-trihydroxy-2-phenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepin-6-yl]-4-aminopyrimidin-2-one (PubChem CID 58940489) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,8R,9R,9aS)-7,8,9-trihydroxy-2-phenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepin-6-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(4aR,6R,7R,8R,9R,9aS)-7,8,9-trihydroxy-2-phenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepin-6-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 58940489 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 1-[(4aR,6R,7R,8R,9R,9aS)-7,8,9-trihydroxy-2-phenyl-4a,6,7,8,9,9a-hexahydro-4H-[1,3]dioxino[5,4-b]oxepin-6-yl]-4-aminopyrimidin-2-one |
| SMILES | Nc1ccn([C@@H]2O[C@@H]3COC(c4ccccc4)O[C@H]3[C@H](O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C18H21N3O7/c19-11-6-7-21(18(25)20-11)16-14(24)12(22)13(23)15-10(27-16)8-26-17(28-15)9-4-2-1-3-5-9/h1-7,10,12-17,22-24H,8H2,(H2,19,20,25)/t10-,12-,13-,14-,15-,16-,17?/m1/s1 |
| InChIKey | UBTPCFGQUAHRDI-PEABTLOMSA-N |
| XLogP | -1.08 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |