C29H30N4O11 — CID 173051692
4-amino-1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxyamino)oxolan-2-yl]pyrimidin-2-one;benzoic acid (PubChem CID 173051692) has the molecular formula C29H30N4O11 and a molecular weight of 610.58 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxyamino)oxolan-2-yl]pyrimidin-2-one;benzoic acid.
| Compound Name | 4-amino-1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxyamino)oxolan-2-yl]pyrimidin-2-one;benzoic acid |
|---|---|
| PubChem CID | 173051692 |
| Molecular Formula | C29H30N4O11 |
| Molecular Weight | 610.58 g/mol |
| Exact Mass | 610.19 |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5S)-3,4-dihydroxy-5-(hydroxyamino)oxolan-2-yl]pyrimidin-2-one;benzoic acid |
| SMILES | Nc1ccn([C@@H]2O[C@H](NO)[C@@H](O)[C@H]2O)c(=O)n1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H12N4O5.3C7H6O2/c9-3-1-2-12(8(15)10-3)7-5(14)4(13)6(11-16)17-7;3*8-7(9)6-4-2-1-3-5-6/h1-2,4-7,11,13-14,16H,(H2,9,10,15);3*1-5H,(H,8,9)/t4-,5+,6-,7+;;;/m0.../s1 |
| InChIKey | SHYGPVQQBVJUNP-LGPMNORRSA-N |
| XLogP | 1.54 |
| TPSA | 254.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|