C12H13FN6O — CID 59157856
N'-[9-[(2R,3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 59157856) has the molecular formula C12H13FN6O and a molecular weight of 276.28 g/mol. Its IUPAC name is N'-[9-[(2R,3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 59157856 |
| Molecular Formula | C12H13FN6O |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N'-[9-[(2R,3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1ncnc2c1ncn2[C@@H]1OC=C[C@@H]1F |
| InChI | InChI=1S/C12H13FN6O/c1-18(2)6-17-10-9-11(15-5-14-10)19(7-16-9)12-8(13)3-4-20-12/h3-8,12H,1-2H3/t8-,12+/m0/s1 |
| InChIKey | SPWPBUMVJJCWKE-QPUJVOFHSA-N |
| XLogP | 1.43 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|