C27H21FN5OP — CID 129084461
[9-[(3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]imino-triphenyl-λ5-phosphane (PubChem CID 129084461) has the molecular formula C27H21FN5OP and a molecular weight of 481.47 g/mol. Its IUPAC name is [9-[(3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]imino-triphenyl-λ5-phosphane.
| Compound Name | [9-[(3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]imino-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 129084461 |
| Molecular Formula | C27H21FN5OP |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [9-[(3S)-3-fluoro-2,3-dihydrofuran-2-yl]purin-6-yl]imino-triphenyl-λ5-phosphane |
| SMILES | F[C@H]1C=COC1n1cnc2c(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)ncnc21 |
| InChI | InChI=1S/C27H21FN5OP/c28-23-16-17-34-27(23)33-19-31-24-25(29-18-30-26(24)33)32-35(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-19,23,27H/t23-,27?/m0/s1 |
| InChIKey | OEVHTKXZKHVGBE-DCCUJTHKSA-N |
| XLogP | 5.02 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|