C18H18ClFN6OSe — CID 140542197
N'-[9-[(2R,3R,4R,5R)-5-chloro-3-fluoro-4-phenylselanyloxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 140542197) has the molecular formula C18H18ClFN6OSe and a molecular weight of 467.79 g/mol. Its IUPAC name is N'-[9-[(2R,3R,4R,5R)-5-chloro-3-fluoro-4-phenylselanyloxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,3R,4R,5R)-5-chloro-3-fluoro-4-phenylselanyloxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 140542197 |
| Molecular Formula | C18H18ClFN6OSe |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | N'-[9-[(2R,3R,4R,5R)-5-chloro-3-fluoro-4-phenylselanyloxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1ncnc2c1ncn2[C@@H]1O[C@H](Cl)[C@H]([Se]c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C18H18ClFN6OSe/c1-25(2)9-24-16-13-17(22-8-21-16)26(10-23-13)18-12(20)14(15(19)27-18)28-11-6-4-3-5-7-11/h3-10,12,14-15,18H,1-2H3/b24-9+/t12-,14+,15-,18+/m0/s1 |
| InChIKey | YYMXOFAEGGGMJC-NHRYPLIGSA-N |
| XLogP | 2.30 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|