C31H27FI2N5O3P — CID 130283626
(E)-1-[(3R,5R)-4-fluoro-3-iodo-5-[6-[(triphenyl-λ5-phosphanylidene)amino]purin-9-yl]oxolan-2-yl]oxy-3-iodobut-2-en-2-ol (PubChem CID 130283626) has the molecular formula C31H27FI2N5O3P and a molecular weight of 821.37 g/mol. Its IUPAC name is (E)-1-[(3R,5R)-4-fluoro-3-iodo-5-[6-[(triphenyl-λ5-phosphanylidene)amino]purin-9-yl]oxolan-2-yl]oxy-3-iodobut-2-en-2-ol.
| Compound Name | (E)-1-[(3R,5R)-4-fluoro-3-iodo-5-[6-[(triphenyl-λ5-phosphanylidene)amino]purin-9-yl]oxolan-2-yl]oxy-3-iodobut-2-en-2-ol |
|---|---|
| PubChem CID | 130283626 |
| Molecular Formula | C31H27FI2N5O3P |
| Molecular Weight | 821.37 g/mol |
| Exact Mass | 820.99 |
| IUPAC Name | (E)-1-[(3R,5R)-4-fluoro-3-iodo-5-[6-[(triphenyl-λ5-phosphanylidene)amino]purin-9-yl]oxolan-2-yl]oxy-3-iodobut-2-en-2-ol |
| SMILES | C/C(I)=C(\O)COC1O[C@@H](n2cnc3c(N=P(c4ccccc4)(c4ccccc4)c4ccccc4)ncnc32)C(F)[C@@H]1I |
| InChI | InChI=1S/C31H27FI2N5O3P/c1-20(33)24(40)17-41-31-26(34)25(32)30(42-31)39-19-37-27-28(35-18-36-29(27)39)38-43(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18-19,25-26,30-31,40H,17H2,1H3/b24-20+/t25?,26-,30+,31?/m0/s1 |
| InChIKey | ROTNYGJMVWRBMW-ZZEPKHRSSA-N |
| XLogP | 6.87 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.37 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|