C17H24FIN5O3P — CID 158229048
N-[9-[(2R,4R)-3-fluoro-4-iodo-5-[[methyl-[(2S)-2-methylbutyl]phosphoryl]methoxy]oxolan-2-yl]purin-6-yl]methanimine (PubChem CID 158229048) has the molecular formula C17H24FIN5O3P and a molecular weight of 523.29 g/mol. Its IUPAC name is N-[9-[(2R,4R)-3-fluoro-4-iodo-5-[[methyl-[(2S)-2-methylbutyl]phosphoryl]methoxy]oxolan-2-yl]purin-6-yl]methanimine.
| Compound Name | N-[9-[(2R,4R)-3-fluoro-4-iodo-5-[[methyl-[(2S)-2-methylbutyl]phosphoryl]methoxy]oxolan-2-yl]purin-6-yl]methanimine |
|---|---|
| PubChem CID | 158229048 |
| Molecular Formula | C17H24FIN5O3P |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | N-[9-[(2R,4R)-3-fluoro-4-iodo-5-[[methyl-[(2S)-2-methylbutyl]phosphoryl]methoxy]oxolan-2-yl]purin-6-yl]methanimine |
| SMILES | C=Nc1ncnc2c1ncn2[C@@H]1OC(OC[P@@](C)(=O)C[C@@H](C)CC)[C@@H](I)C1F |
| InChI | InChI=1S/C17H24FIN5O3P/c1-5-10(2)6-28(4,25)9-26-17-12(19)11(18)16(27-17)24-8-23-13-14(20-3)21-7-22-15(13)24/h7-8,10-12,16-17H,3,5-6,9H2,1-2,4H3/t10-,11?,12-,16+,17?,28-/m0/s1 |
| InChIKey | HAUVWPHJSKURGT-NIJBZFSUSA-N |
| XLogP | 4.17 |
| TPSA | 91.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|