C17H27FN5O5P — CID 166909322
1-[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-propan-2-yloxolan-2-yl]ethoxy-propylphosphinic acid (PubChem CID 166909322) has the molecular formula C17H27FN5O5P and a molecular weight of 431.41 g/mol. Its IUPAC name is 1-[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-propan-2-yloxolan-2-yl]ethoxy-propylphosphinic acid.
| Compound Name | 1-[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-propan-2-yloxolan-2-yl]ethoxy-propylphosphinic acid |
|---|---|
| PubChem CID | 166909322 |
| Molecular Formula | C17H27FN5O5P |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-[5-(2-amino-6-oxo-1H-purin-9-yl)-4-fluoro-3-propan-2-yloxolan-2-yl]ethoxy-propylphosphinic acid |
| SMILES | CCCP(=O)(O)OC(C)C1OC(n2cnc3c(=O)[nH]c(N)nc32)C(F)C1C(C)C |
| InChI | InChI=1S/C17H27FN5O5P/c1-5-6-29(25,26)28-9(4)13-10(8(2)3)11(18)16(27-13)23-7-20-12-14(23)21-17(19)22-15(12)24/h7-11,13,16H,5-6H2,1-4H3,(H,25,26)(H3,19,21,22,24) |
| InChIKey | NJCPNUVYZLMKLA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|