C10H11FN5O — CID 58521297
CID 58521297 (PubChem CID 58521297) has the molecular formula C10H11FN5O and a molecular weight of 236.23 g/mol.
| Compound Name | CID 58521297 |
|---|---|
| PubChem CID | 58521297 |
| Molecular Formula | C10H11FN5O |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | — |
| SMILES | C[C@@H]1[CH]O[C@@H](n2cnc3c(N)ncnc32)[C@H]1F |
| InChI | InChI=1S/C10H11FN5O/c1-5-2-17-10(6(5)11)16-4-15-7-8(12)13-3-14-9(7)16/h2-6,10H,1H3,(H2,12,13,14)/t5-,6+,10-/m1/s1 |
| InChIKey | CLLRIOSFMXJNRA-GOZTUDAPSA-N |
| XLogP | 1.07 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |