C12H18ClN6O6P — CID 175398037
chlorooxy 1-[6-(dimethylaminomethylideneamino)purin-9-yl]propan-2-yloxy methyl phosphate (PubChem CID 175398037) has the molecular formula C12H18ClN6O6P and a molecular weight of 408.74 g/mol. Its IUPAC name is chlorooxy 1-[6-(dimethylaminomethylideneamino)purin-9-yl]propan-2-yloxy methyl phosphate.
| Compound Name | chlorooxy 1-[6-(dimethylaminomethylideneamino)purin-9-yl]propan-2-yloxy methyl phosphate |
|---|---|
| PubChem CID | 175398037 |
| Molecular Formula | C12H18ClN6O6P |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | chlorooxy 1-[6-(dimethylaminomethylideneamino)purin-9-yl]propan-2-yloxy methyl phosphate |
| SMILES | CO[P@@](=O)(OOCl)OOC(C)Cn1cnc2c(N=CN(C)C)ncnc21 |
| InChI | InChI=1S/C12H18ClN6O6P/c1-9(22-24-26(20,21-4)25-23-13)5-19-8-16-10-11(17-7-18(2)3)14-6-15-12(10)19/h6-9H,5H2,1-4H3/t9?,26-/m1/s1 |
| InChIKey | RTXAHNQGHDLLFW-BVGZEAIISA-N |
| XLogP | 2.24 |
| TPSA | 122.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|