C13H22N5O4PS2 — CID 137411099
9-[(2R)-2-[[methoxy-[2-(methyldisulfanyl)ethoxy]phosphoryl]methoxy]propyl]purin-6-amine (PubChem CID 137411099) has the molecular formula C13H22N5O4PS2 and a molecular weight of 407.46 g/mol. Its IUPAC name is 9-[(2R)-2-[[methoxy-[2-(methyldisulfanyl)ethoxy]phosphoryl]methoxy]propyl]purin-6-amine.
| Compound Name | 9-[(2R)-2-[[methoxy-[2-(methyldisulfanyl)ethoxy]phosphoryl]methoxy]propyl]purin-6-amine |
|---|---|
| PubChem CID | 137411099 |
| Molecular Formula | C13H22N5O4PS2 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 9-[(2R)-2-[[methoxy-[2-(methyldisulfanyl)ethoxy]phosphoryl]methoxy]propyl]purin-6-amine |
| SMILES | COP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCCSSC |
| InChI | InChI=1S/C13H22N5O4PS2/c1-10(21-9-23(19,20-2)22-4-5-25-24-3)6-18-8-17-11-12(14)15-7-16-13(11)18/h7-8,10H,4-6,9H2,1-3H3,(H2,14,15,16)/t10-,23?/m1/s1 |
| InChIKey | URCBFSACGFNDEC-WXHONRPMSA-N |
| XLogP | 2.64 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|