C27H42N9O6P — CID 153362437
N'-[9-[(2R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)-2,3-dihydrofuran-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 153362437) has the molecular formula C27H42N9O6P and a molecular weight of 619.66 g/mol. Its IUPAC name is N'-[9-[(2R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)-2,3-dihydrofuran-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)-2,3-dihydrofuran-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 153362437 |
| Molecular Formula | C27H42N9O6P |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | N'-[9-[(2R)-4-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)-2,3-dihydrofuran-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | COC1C(OP(OCCC#N)N(C(C)C)C(C)C)=C(CN2CCOCC2)O[C@H]1n1cnc2c(=O)[nH]c(/N=C/N(C)C)nc21 |
| InChI | InChI=1S/C27H42N9O6P/c1-18(2)36(19(3)4)43(40-12-8-9-28)42-22-20(15-34-10-13-39-14-11-34)41-26(23(22)38-7)35-17-29-21-24(35)31-27(32-25(21)37)30-16-33(5)6/h16-19,23,26H,8,10-15H2,1-7H3,(H,31,32,37)/b30-16+/t23?,26-,43?/m1/s1 |
| InChIKey | WSRFKWBOKOKZQH-JONUDGEDSA-N |
| XLogP | 2.72 |
| TPSA | 155.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|