C25H40N7O5P — CID 157285423
N-[9-[(2R,3R,4R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-4-methyloxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide (PubChem CID 157285423) has the molecular formula C25H40N7O5P and a molecular weight of 549.61 g/mol. Its IUPAC name is N-[9-[(2R,3R,4R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-4-methyloxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide.
| Compound Name | N-[9-[(2R,3R,4R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-4-methyloxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 157285423 |
| Molecular Formula | C25H40N7O5P |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | N-[9-[(2R,3R,4R,5R)-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-5-ethyl-4-methyloxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide |
| SMILES | CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(NC(=O)C(C)C)nc32)[C@H](OP(OCCC#N)N(C(C)C)C(C)C)[C@@H]1C |
| InChI | InChI=1S/C25H40N7O5P/c1-9-18-17(8)20(37-38(35-12-10-11-26)32(15(4)5)16(6)7)24(36-18)31-13-27-19-21(31)28-25(30-23(19)34)29-22(33)14(2)3/h13-18,20,24H,9-10,12H2,1-8H3,(H2,28,29,30,33,34)/t17-,18-,20-,24-,38?/m1/s1 |
| InChIKey | MOULCTOMXNVLOT-DSWCQJRWSA-N |
| XLogP | 4.32 |
| TPSA | 147.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|