C25H39N7O6P- — CID 163652841
2-[(2R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]ethanolate (PubChem CID 163652841) has the molecular formula C25H39N7O6P- and a molecular weight of 564.60 g/mol. Its IUPAC name is 2-[(2R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]ethanolate.
| Compound Name | 2-[(2R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]ethanolate |
|---|---|
| PubChem CID | 163652841 |
| Molecular Formula | C25H39N7O6P- |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 2-[(2R)-2-[[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxymethyl]-5-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]oxolan-2-yl]ethanolate |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2C2CC[C@@](CC[O-])(COP(OCCC#N)N(C(C)C)C(C)C)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H39N7O6P/c1-16(2)22(34)29-24-28-21-20(23(35)30-24)27-15-31(21)19-8-9-25(38-19,10-12-33)14-37-39(36-13-7-11-26)32(17(3)4)18(5)6/h15-19H,7-10,12-14H2,1-6H3,(H2,28,29,30,34,35)/q-1/t19?,25-,39?/m1/s1 |
| InChIKey | INRRFJOJTSYXFF-CADBSQJCSA-N |
| XLogP | 2.80 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|