C26H43IN7O8P — CID 155737056
[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[2-(2-methoxyethoxy)-1-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethoxy]propyl] hypoiodite (PubChem CID 155737056) has the molecular formula C26H43IN7O8P and a molecular weight of 739.55 g/mol. Its IUPAC name is [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[2-(2-methoxyethoxy)-1-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethoxy]propyl] hypoiodite.
| Compound Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[2-(2-methoxyethoxy)-1-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethoxy]propyl] hypoiodite |
|---|---|
| PubChem CID | 155737056 |
| Molecular Formula | C26H43IN7O8P |
| Molecular Weight | 739.55 g/mol |
| Exact Mass | 739.20 |
| IUPAC Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[2-(2-methoxyethoxy)-1-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethoxy]propyl] hypoiodite |
| SMILES | COCCOCC(OC(COI)COP(OCCC#N)N(C(C)C)C(C)C)n1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C26H43IN7O8P/c1-17(2)24(35)31-26-30-23-22(25(36)32-26)29-16-33(23)21(15-38-12-11-37-7)42-20(13-39-27)14-41-43(40-10-8-9-28)34(18(3)4)19(5)6/h16-21H,8,10-15H2,1-7H3,(H2,30,31,32,35,36) |
| InChIKey | XWSDUAMSVBUFTA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 175.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|