C21H36IN4O9P — CID 155737060
[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-(2-methoxyethoxy)ethoxy]propoxy] hypoiodite (PubChem CID 155737060) has the molecular formula C21H36IN4O9P and a molecular weight of 646.42 g/mol. Its IUPAC name is [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-(2-methoxyethoxy)ethoxy]propoxy] hypoiodite.
| Compound Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-(2-methoxyethoxy)ethoxy]propoxy] hypoiodite |
|---|---|
| PubChem CID | 155737060 |
| Molecular Formula | C21H36IN4O9P |
| Molecular Weight | 646.42 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-(2-methoxyethoxy)ethoxy]propoxy] hypoiodite |
| SMILES | COCCOCC(OC(COOI)COP(OCCC#N)N(C(C)C)C(C)C)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C21H36IN4O9P/c1-16(2)26(17(3)4)36(32-10-6-8-23)33-14-18(13-31-35-22)34-20(15-30-12-11-29-5)25-9-7-19(27)24-21(25)28/h7,9,16-18,20H,6,10-15H2,1-5H3,(H,24,27,28) |
| InChIKey | LAESNKVMEIDELM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|