C18H29FIN4O6P — CID 155737068
[3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-fluoroethoxy]propyl] hypoiodite (PubChem CID 155737068) has the molecular formula C18H29FIN4O6P and a molecular weight of 574.33 g/mol. Its IUPAC name is [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-fluoroethoxy]propyl] hypoiodite.
| Compound Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-fluoroethoxy]propyl] hypoiodite |
|---|---|
| PubChem CID | 155737068 |
| Molecular Formula | C18H29FIN4O6P |
| Molecular Weight | 574.33 g/mol |
| Exact Mass | 574.09 |
| IUPAC Name | [3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxy-2-[1-(2,4-dioxopyrimidin-1-yl)-2-fluoroethoxy]propyl] hypoiodite |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(COI)OC(CF)n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C18H29FIN4O6P/c1-13(2)24(14(3)4)31(28-9-5-7-21)29-12-15(11-27-20)30-17(10-19)23-8-6-16(25)22-18(23)26/h6,8,13-15,17H,5,9-12H2,1-4H3,(H,22,25,26) |
| InChIKey | YQKWNXMNWSSQLI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 118.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|