C25H31N6O7P — CID 136590825
[(2R)-2-[(2R)-1-[2-cyanoethoxy(methyl)phosphanyl]oxy-3-deuteriopropan-2-yl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethyl] benzoate (PubChem CID 136590825) has the molecular formula C25H31N6O7P and a molecular weight of 559.54 g/mol. Its IUPAC name is [(2R)-2-[(2R)-1-[2-cyanoethoxy(methyl)phosphanyl]oxy-3-deuteriopropan-2-yl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethyl] benzoate.
| Compound Name | [(2R)-2-[(2R)-1-[2-cyanoethoxy(methyl)phosphanyl]oxy-3-deuteriopropan-2-yl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethyl] benzoate |
|---|---|
| PubChem CID | 136590825 |
| Molecular Formula | C25H31N6O7P |
| Molecular Weight | 559.54 g/mol |
| Exact Mass | 559.21 |
| IUPAC Name | [(2R)-2-[(2R)-1-[2-cyanoethoxy(methyl)phosphanyl]oxy-3-deuteriopropan-2-yl]oxy-2-[2-(2-methylpropanoylamino)-6-oxo-1H-purin-9-yl]ethyl] benzoate |
| SMILES | [2H]C[C@H](COP(C)OCCC#N)O[C@H](COC(=O)c1ccccc1)n1cnc2c(=O)[nH]c(NC(=O)C(C)C)nc21 |
| InChI | InChI=1S/C25H31N6O7P/c1-16(2)22(32)29-25-28-21-20(23(33)30-25)27-15-31(21)19(14-35-24(34)18-9-6-5-7-10-18)38-17(3)13-37-39(4)36-12-8-11-26/h5-7,9-10,15-17,19H,8,12-14H2,1-4H3,(H2,28,29,30,32,33)/t17-,19-,39?/m1/s1/i3D |
| InChIKey | HVKOBCFCKIEOKG-WRDLDFTHSA-N |
| XLogP | 3.36 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|