C21H36N6O4Si — CID 162155117
9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]purin-6-amine (PubChem CID 162155117) has the molecular formula C21H36N6O4Si and a molecular weight of 464.64 g/mol. Its IUPAC name is 9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 162155117 |
| Molecular Formula | C21H36N6O4Si |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | 9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]purin-6-amine |
| SMILES | CO[C@H]1C(O[Si](C)(C)C(C)(C)C)[C@@H](CN2CCOCC2)O[C@H]1n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H36N6O4Si/c1-21(2,3)32(5,6)31-16-14(11-26-7-9-29-10-8-26)30-20(17(16)28-4)27-13-25-15-18(22)23-12-24-19(15)27/h12-14,16-17,20H,7-11H2,1-6H3,(H2,22,23,24)/t14-,16?,17+,20-/m1/s1 |
| InChIKey | MCPKANOJWOGEAZ-ASQPVTKTSA-N |
| XLogP | 2.04 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|