C34H34O6S — CID 10603138
S-benzyl (2S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolane-2-carbothioate (PubChem CID 10603138) has the molecular formula C34H34O6S and a molecular weight of 570.71 g/mol. Its IUPAC name is S-benzyl (2S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolane-2-carbothioate.
| Compound Name | S-benzyl (2S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolane-2-carbothioate |
|---|---|
| PubChem CID | 10603138 |
| Molecular Formula | C34H34O6S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | S-benzyl (2S,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolane-2-carbothioate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@H](C(=O)SCc3ccccc3)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H34O6S/c1-37-28-17-13-26(14-18-28)34(25-11-7-4-8-12-25,27-15-19-29(38-2)20-16-27)39-22-32-30(35)21-31(40-32)33(36)41-23-24-9-5-3-6-10-24/h3-20,30-32,35H,21-23H2,1-2H3/t30-,31-,32+/m0/s1 |
| InChIKey | NGCAYTBCADSOOA-OWHBQTKESA-N |
| XLogP | 5.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|