C36H41ClN8O4Si — CID 140850992
9-[(2R,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-chloropurin-6-amine (PubChem CID 140850992) has the molecular formula C36H41ClN8O4Si and a molecular weight of 713.32 g/mol. Its IUPAC name is 9-[(2R,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-chloropurin-6-amine.
| Compound Name | 9-[(2R,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-chloropurin-6-amine |
|---|---|
| PubChem CID | 140850992 |
| Molecular Formula | C36H41ClN8O4Si |
| Molecular Weight | 713.32 g/mol |
| Exact Mass | 712.27 |
| IUPAC Name | 9-[(2R,3R,4R,5S)-4-azido-3-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-chloropurin-6-amine |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N)nc(Cl)nc43)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2N=[N+]=[N-])(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H41ClN8O4Si/c1-35(2,3)50(5,6)49-30-28(43-44-39)27(48-33(30)45-22-40-29-31(38)41-34(37)42-32(29)45)21-47-36(23-13-9-7-10-14-23,24-15-11-8-12-16-24)25-17-19-26(46-4)20-18-25/h7-20,22,27-28,30,33H,21H2,1-6H3,(H2,38,41,42)/t27-,28-,30-,33-/m1/s1 |
| InChIKey | NZBJPWYDEHDKLM-GWDKBUGCSA-N |
| XLogP | 8.05 |
| TPSA | 155.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.32 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|