C29H46IN5O3Si2 — CID 59736557
9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[(4-iodophenyl)methyl]purin-6-amine (PubChem CID 59736557) has the molecular formula C29H46IN5O3Si2 and a molecular weight of 695.80 g/mol. Its IUPAC name is 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[(4-iodophenyl)methyl]purin-6-amine.
| Compound Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[(4-iodophenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 59736557 |
| Molecular Formula | C29H46IN5O3Si2 |
| Molecular Weight | 695.80 g/mol |
| Exact Mass | 695.22 |
| IUPAC Name | 9-[(2R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-N-[(4-iodophenyl)methyl]purin-6-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cnc3c(NCc4ccc(I)cc4)ncnc32)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H46IN5O3Si2/c1-28(2,3)39(7,8)36-17-23-22(38-40(9,10)29(4,5)6)15-24(37-23)35-19-34-25-26(32-18-33-27(25)35)31-16-20-11-13-21(30)14-12-20/h11-14,18-19,22-24H,15-17H2,1-10H3,(H,31,32,33)/t22?,23-,24-/m1/s1 |
| InChIKey | GLDOIMXBCPFNSC-HEYJASKDSA-N |
| XLogP | 7.74 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.80 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|